About (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine
(6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine (PubChem CID 82503893) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine.
Analyze (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine?
The IUPAC name of (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine (CID 82503893) is (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine.
What is the SMILES notation for (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine?
The canonical SMILES for (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine is CCc1nc2sccn2c1CN.
What is the InChIKey of (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine?
The InChIKey is MCHGSBQTYMFHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-2-6-7(5-9)11-3-4-12-8(11)10-6/h3-4H,2,5,9H2,1H3.
What are the key properties of (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine?
(6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine has a molecular weight of 181.26 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethylimidazo[2,1-b][1,3]thiazol-5-yl)methanamine is sourced from PubChem (CID 82503893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).