C10H12N2S — CID 130512598
6-cyclopropyl-5-ethylimidazo[2,1-b][1,3]thiazole (PubChem CID 130512598) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 6-cyclopropyl-5-ethylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-cyclopropyl-5-ethylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 130512598 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 6-cyclopropyl-5-ethylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCc1c(C2CC2)nc2sccn12 |
| InChI | InChI=1S/C10H12N2S/c1-2-8-9(7-3-4-7)11-10-12(8)5-6-13-10/h5-7H,2-4H2,1H3 |
| InChIKey | MRTLVHOKSXQMSL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |