C12H11ClN4S — CID 62489333
5-(chloromethyl)-6-(3-cyclopropylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 62489333) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(3-cyclopropylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(chloromethyl)-6-(3-cyclopropylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 62489333 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 5-(chloromethyl)-6-(3-cyclopropylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | ClCc1c(-n2ccc(C3CC3)n2)nc2sccn12 |
| InChI | InChI=1S/C12H11ClN4S/c13-7-10-11(14-12-16(10)5-6-18-12)17-4-3-9(15-17)8-1-2-8/h3-6,8H,1-2,7H2 |
| InChIKey | LZJBHDQQDNLCAH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|