C12H18ClN3S — CID 43476018
5-(chloromethyl)-N-propan-2-yl-N-propylimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 43476018) has the molecular formula C12H18ClN3S and a molecular weight of 271.82 g/mol. Its IUPAC name is 5-(chloromethyl)-N-propan-2-yl-N-propylimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(chloromethyl)-N-propan-2-yl-N-propylimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 43476018 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-(chloromethyl)-N-propan-2-yl-N-propylimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CCCN(c1nc2sccn2c1CCl)C(C)C |
| InChI | InChI=1S/C12H18ClN3S/c1-4-5-15(9(2)3)11-10(8-13)16-6-7-17-12(16)14-11/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | AYOXNKNROWBIHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|