C10H14ClN3O2S2 — CID 79849748
5-(chloromethyl)-N-methyl-N-(2-methylsulfonylethyl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 79849748) has the molecular formula C10H14ClN3O2S2 and a molecular weight of 307.83 g/mol. Its IUPAC name is 5-(chloromethyl)-N-methyl-N-(2-methylsulfonylethyl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(chloromethyl)-N-methyl-N-(2-methylsulfonylethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 79849748 |
| Molecular Formula | C10H14ClN3O2S2 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 5-(chloromethyl)-N-methyl-N-(2-methylsulfonylethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CN(CCS(C)(=O)=O)c1nc2sccn2c1CCl |
| InChI | InChI=1S/C10H14ClN3O2S2/c1-13(4-6-18(2,15)16)9-8(7-11)14-3-5-17-10(14)12-9/h3,5H,4,6-7H2,1-2H3 |
| InChIKey | FBWDAWWPMGGIDK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|