C14H20BrN3O — CID 107084898
3-(bromomethyl)-N-(2-methoxyethyl)-N-propan-2-ylimidazo[1,2-a]pyridin-2-amine (PubChem CID 107084898) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 3-(bromomethyl)-N-(2-methoxyethyl)-N-propan-2-ylimidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-(bromomethyl)-N-(2-methoxyethyl)-N-propan-2-ylimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 107084898 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-(bromomethyl)-N-(2-methoxyethyl)-N-propan-2-ylimidazo[1,2-a]pyridin-2-amine |
| SMILES | COCCN(c1nc2ccccn2c1CBr)C(C)C |
| InChI | InChI=1S/C14H20BrN3O/c1-11(2)17(8-9-19-3)14-12(10-15)18-7-5-4-6-13(18)16-14/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | NEJSPUYXUYEURN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|