C12H13BrF3N3 — CID 107084185
3-(bromomethyl)-N-methyl-N-(3,3,3-trifluoropropyl)imidazo[1,2-a]pyridin-2-amine (PubChem CID 107084185) has the molecular formula C12H13BrF3N3 and a molecular weight of 336.16 g/mol. Its IUPAC name is 3-(bromomethyl)-N-methyl-N-(3,3,3-trifluoropropyl)imidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-(bromomethyl)-N-methyl-N-(3,3,3-trifluoropropyl)imidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 107084185 |
| Molecular Formula | C12H13BrF3N3 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-(bromomethyl)-N-methyl-N-(3,3,3-trifluoropropyl)imidazo[1,2-a]pyridin-2-amine |
| SMILES | CN(CCC(F)(F)F)c1nc2ccccn2c1CBr |
| InChI | InChI=1S/C12H13BrF3N3/c1-18(7-5-12(14,15)16)11-9(8-13)19-6-3-2-4-10(19)17-11/h2-4,6H,5,7-8H2,1H3 |
| InChIKey | OASRSZBWZGTEGZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|