C16H13BrN4 — CID 107083029
4-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-methylamino]benzonitrile (PubChem CID 107083029) has the molecular formula C16H13BrN4 and a molecular weight of 341.21 g/mol. Its IUPAC name is 4-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-methylamino]benzonitrile.
| Compound Name | 4-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-methylamino]benzonitrile |
|---|---|
| PubChem CID | 107083029 |
| Molecular Formula | C16H13BrN4 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-methylamino]benzonitrile |
| SMILES | CN(c1ccc(C#N)cc1)c1nc2ccccn2c1CBr |
| InChI | InChI=1S/C16H13BrN4/c1-20(13-7-5-12(11-18)6-8-13)16-14(10-17)21-9-3-2-4-15(21)19-16/h2-9H,10H2,1H3 |
| InChIKey | BAEACBQMQAIQPI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|