C10H12ClN3 — CID 43478139
3-(chloromethyl)-N,N-dimethylimidazo[1,2-a]pyridin-2-amine (PubChem CID 43478139) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 3-(chloromethyl)-N,N-dimethylimidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-(chloromethyl)-N,N-dimethylimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 43478139 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 3-(chloromethyl)-N,N-dimethylimidazo[1,2-a]pyridin-2-amine |
| SMILES | CN(C)c1nc2ccccn2c1CCl |
| InChI | InChI=1S/C10H12ClN3/c1-13(2)10-8(7-11)14-6-4-3-5-9(14)12-10/h3-6H,7H2,1-2H3 |
| InChIKey | ZHLUULMBLZNAHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|