C14H15BrN4 — CID 107081879
3-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-cyclopropylamino]propanenitrile (PubChem CID 107081879) has the molecular formula C14H15BrN4 and a molecular weight of 319.21 g/mol. Its IUPAC name is 3-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-cyclopropylamino]propanenitrile.
| Compound Name | 3-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-cyclopropylamino]propanenitrile |
|---|---|
| PubChem CID | 107081879 |
| Molecular Formula | C14H15BrN4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-[[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-cyclopropylamino]propanenitrile |
| SMILES | N#CCCN(c1nc2ccccn2c1CBr)C1CC1 |
| InChI | InChI=1S/C14H15BrN4/c15-10-12-14(17-13-4-1-2-8-19(12)13)18(9-3-7-16)11-5-6-11/h1-2,4,8,11H,3,5-6,9-10H2 |
| InChIKey | ZCCNQPNXTQVNKU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|