C16H15BrClN3 — CID 107080940
3-(bromomethyl)-N-[(3-chlorophenyl)methyl]-N-methylimidazo[1,2-a]pyridin-2-amine (PubChem CID 107080940) has the molecular formula C16H15BrClN3 and a molecular weight of 364.67 g/mol. Its IUPAC name is 3-(bromomethyl)-N-[(3-chlorophenyl)methyl]-N-methylimidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-(bromomethyl)-N-[(3-chlorophenyl)methyl]-N-methylimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 107080940 |
| Molecular Formula | C16H15BrClN3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 3-(bromomethyl)-N-[(3-chlorophenyl)methyl]-N-methylimidazo[1,2-a]pyridin-2-amine |
| SMILES | CN(Cc1cccc(Cl)c1)c1nc2ccccn2c1CBr |
| InChI | InChI=1S/C16H15BrClN3/c1-20(11-12-5-4-6-13(18)9-12)16-14(10-17)21-8-3-2-7-15(21)19-16/h2-9H,10-11H2,1H3 |
| InChIKey | YPDZHMIXWKOCPS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|