C14H14BrN3OS — CID 107082506
5-(bromomethyl)-N-(4-methoxyphenyl)-N-methylimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 107082506) has the molecular formula C14H14BrN3OS and a molecular weight of 352.26 g/mol. Its IUPAC name is 5-(bromomethyl)-N-(4-methoxyphenyl)-N-methylimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(bromomethyl)-N-(4-methoxyphenyl)-N-methylimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 107082506 |
| Molecular Formula | C14H14BrN3OS |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 5-(bromomethyl)-N-(4-methoxyphenyl)-N-methylimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | COc1ccc(N(C)c2nc3sccn3c2CBr)cc1 |
| InChI | InChI=1S/C14H14BrN3OS/c1-17(10-3-5-11(19-2)6-4-10)13-12(9-15)18-7-8-20-14(18)16-13/h3-8H,9H2,1-2H3 |
| InChIKey | LNDHOPILQXMULT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|