6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid

C13H7N3O3S — CID 43475883

IUPAC6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid
SMILESN#Cc1ccc(Oc2nc3sccn3c2C(=O)O)cc1
InChIInChI=1S/C13H7N3O3S/c14-7-8-1-3-9(4-2-8)19-11-10(12(17)18)16-5-6-20-13(16)15-11/h1-6H,(H,17,18)
InChIKeyDCLRPXBMARWFJL-UHFFFAOYSA-N
MW285.28 g/mol
LogP2.76
Rot. Bonds3

About 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid

6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 43475883) has the molecular formula C13H7N3O3S and a molecular weight of 285.28 g/mol. Its IUPAC name is 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid.

Molecular Properties

Compound Name6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid
PubChem CID43475883
Molecular FormulaC13H7N3O3S
Molecular Weight285.28 g/mol
Exact Mass285.02
IUPAC Name6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid
SMILESN#Cc1ccc(Oc2nc3sccn3c2C(=O)O)cc1
InChIInChI=1S/C13H7N3O3S/c14-7-8-1-3-9(4-2-8)19-11-10(12(17)18)16-5-6-20-13(16)15-11/h1-6H,(H,17,18)
InChIKeyDCLRPXBMARWFJL-UHFFFAOYSA-N
XLogP2.76
TPSA87.62 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.28
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The IUPAC name of 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CID 43475883) is 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
What is the SMILES notation for 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The canonical SMILES for 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid is N#Cc1ccc(Oc2nc3sccn3c2C(=O)O)cc1.
What is the InChIKey of 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The InChIKey is DCLRPXBMARWFJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N3O3S/c14-7-8-1-3-9(4-2-8)19-11-10(12(17)18)16-5-6-20-13(16)15-11/h1-6H,(H,17,18).
What are the key properties of 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid has a molecular weight of 285.28 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-cyanophenoxy)imidazo[2,1-b][1,3]thiazole-5-carboxylic acid is sourced from PubChem (CID 43475883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).