C14H13BrN2O2S — CID 107086633
5-(bromomethyl)-6-(4-ethoxyphenoxy)imidazo[2,1-b][1,3]thiazole (PubChem CID 107086633) has the molecular formula C14H13BrN2O2S and a molecular weight of 353.24 g/mol. Its IUPAC name is 5-(bromomethyl)-6-(4-ethoxyphenoxy)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(bromomethyl)-6-(4-ethoxyphenoxy)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 107086633 |
| Molecular Formula | C14H13BrN2O2S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 5-(bromomethyl)-6-(4-ethoxyphenoxy)imidazo[2,1-b][1,3]thiazole |
| SMILES | CCOc1ccc(Oc2nc3sccn3c2CBr)cc1 |
| InChI | InChI=1S/C14H13BrN2O2S/c1-2-18-10-3-5-11(6-4-10)19-13-12(9-15)17-7-8-20-14(17)16-13/h3-8H,2,9H2,1H3 |
| InChIKey | RSQFOKFSJWFMMC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|