C12H7BrFN3O3S — CID 107089176
5-(bromomethyl)-6-(2-fluoro-6-nitrophenoxy)imidazo[2,1-b][1,3]thiazole (PubChem CID 107089176) has the molecular formula C12H7BrFN3O3S and a molecular weight of 372.18 g/mol. Its IUPAC name is 5-(bromomethyl)-6-(2-fluoro-6-nitrophenoxy)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(bromomethyl)-6-(2-fluoro-6-nitrophenoxy)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 107089176 |
| Molecular Formula | C12H7BrFN3O3S |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 5-(bromomethyl)-6-(2-fluoro-6-nitrophenoxy)imidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1cccc(F)c1Oc1nc2sccn2c1CBr |
| InChI | InChI=1S/C12H7BrFN3O3S/c13-6-9-11(15-12-16(9)4-5-21-12)20-10-7(14)2-1-3-8(10)17(18)19/h1-5H,6H2 |
| InChIKey | IBRYSHKPSSYEQA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|