C12H9BrN4O3S — CID 65429632
[6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanamine (PubChem CID 65429632) has the molecular formula C12H9BrN4O3S and a molecular weight of 369.20 g/mol. Its IUPAC name is [6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanamine.
| Compound Name | [6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 65429632 |
| Molecular Formula | C12H9BrN4O3S |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | [6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanamine |
| SMILES | NCc1c(Oc2ccc(Br)cc2[N+](=O)[O-])nc2sccn12 |
| InChI | InChI=1S/C12H9BrN4O3S/c13-7-1-2-10(8(5-7)17(18)19)20-11-9(6-14)16-3-4-21-12(16)15-11/h1-5H,6,14H2 |
| InChIKey | PLGDKMSVBRWUNJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|