C12H8BrN3O4S — CID 65429809
[6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol (PubChem CID 65429809) has the molecular formula C12H8BrN3O4S and a molecular weight of 370.18 g/mol. Its IUPAC name is [6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol.
| Compound Name | [6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 65429809 |
| Molecular Formula | C12H8BrN3O4S |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | [6-(4-bromo-2-nitrophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]methanol |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1Oc1nc2sccn2c1CO |
| InChI | InChI=1S/C12H8BrN3O4S/c13-7-1-2-10(8(5-7)16(18)19)20-11-9(6-17)15-3-4-21-12(15)14-11/h1-5,17H,6H2 |
| InChIKey | GLOUYPBXSACRMT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|