C12H8ClFN2OS — CID 43476148
5-(chloromethyl)-6-(3-fluorophenoxy)imidazo[2,1-b][1,3]thiazole (PubChem CID 43476148) has the molecular formula C12H8ClFN2OS and a molecular weight of 282.73 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(3-fluorophenoxy)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(chloromethyl)-6-(3-fluorophenoxy)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 43476148 |
| Molecular Formula | C12H8ClFN2OS |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 5-(chloromethyl)-6-(3-fluorophenoxy)imidazo[2,1-b][1,3]thiazole |
| SMILES | Fc1cccc(Oc2nc3sccn3c2CCl)c1 |
| InChI | InChI=1S/C12H8ClFN2OS/c13-7-10-11(15-12-16(10)4-5-18-12)17-9-3-1-2-8(14)6-9/h1-6H,7H2 |
| InChIKey | BGRAVHPQUQHVEC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|