C12H6Cl4N2OS — CID 43476068
5-(chloromethyl)-6-(2,4,5-trichlorophenoxy)imidazo[2,1-b][1,3]thiazole (PubChem CID 43476068) has the molecular formula C12H6Cl4N2OS and a molecular weight of 368.07 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(2,4,5-trichlorophenoxy)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(chloromethyl)-6-(2,4,5-trichlorophenoxy)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 43476068 |
| Molecular Formula | C12H6Cl4N2OS |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | 5-(chloromethyl)-6-(2,4,5-trichlorophenoxy)imidazo[2,1-b][1,3]thiazole |
| SMILES | ClCc1c(Oc2cc(Cl)c(Cl)cc2Cl)nc2sccn12 |
| InChI | InChI=1S/C12H6Cl4N2OS/c13-5-9-11(17-12-18(9)1-2-20-12)19-10-4-7(15)6(14)3-8(10)16/h1-4H,5H2 |
| InChIKey | YIQWNKZGWJXGML-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|