C13H10BrCl2N3OS — CID 107659553
1-[6-(4-bromo-2,5-dichlorophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine (PubChem CID 107659553) has the molecular formula C13H10BrCl2N3OS and a molecular weight of 407.12 g/mol. Its IUPAC name is 1-[6-(4-bromo-2,5-dichlorophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[6-(4-bromo-2,5-dichlorophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107659553 |
| Molecular Formula | C13H10BrCl2N3OS |
| Molecular Weight | 407.12 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | 1-[6-(4-bromo-2,5-dichlorophenoxy)imidazo[2,1-b][1,3]thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1c(Oc2cc(Cl)c(Br)cc2Cl)nc2sccn12 |
| InChI | InChI=1S/C13H10BrCl2N3OS/c1-17-6-10-12(18-13-19(10)2-3-21-13)20-11-5-8(15)7(14)4-9(11)16/h2-5,17H,6H2,1H3 |
| InChIKey | CBTYZLBLCVHODA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.12 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|