C9H4ClN3O2S — CID 43132250
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyanoprop-2-enoic acid (PubChem CID 43132250) has the molecular formula C9H4ClN3O2S and a molecular weight of 253.67 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 43132250 |
| Molecular Formula | C9H4ClN3O2S |
| Molecular Weight | 253.67 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1c(Cl)nc2sccn12)C(=O)O |
| InChI | InChI=1S/C9H4ClN3O2S/c10-7-6(3-5(4-11)8(14)15)13-1-2-16-9(13)12-7/h1-3H,(H,14,15)/b5-3+ |
| InChIKey | GCUSUDSQZGHTPG-HWKANZROSA-N |
| XLogP | 2.04 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|