C9H7ClN2OS — CID 79330598
3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal (PubChem CID 79330598) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal.
| Compound Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal |
|---|---|
| PubChem CID | 79330598 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-methylprop-2-enal |
| SMILES | CC(C=O)=Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C9H7ClN2OS/c1-6(5-13)4-7-8(10)11-9-12(7)2-3-14-9/h2-5H,1H3 |
| InChIKey | QGJWPFHFMPAEMK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|