C19H15ClN4O — CID 43000969
(E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide (PubChem CID 43000969) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43000969 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)-2-cyano-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C/c1c(Cl)nc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN4O/c1-13(14-7-3-2-4-8-14)22-19(25)15(12-21)11-16-18(20)23-17-9-5-6-10-24(16)17/h2-11,13H,1H3,(H,22,25)/b15-11+ |
| InChIKey | COQYELGKHXHCRF-RVDMUPIBSA-N |
| XLogP | 3.77 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|