C15H9ClN4OS2 — CID 136577248
5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 136577248) has the molecular formula C15H9ClN4OS2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136577248 |
| Molecular Formula | C15H9ClN4OS2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccccc2)SC1=Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C15H9ClN4OS2/c16-12-10(20-6-7-22-15(20)18-12)8-11-13(21)19-14(23-11)17-9-4-2-1-3-5-9/h1-8H,(H,17,19,21) |
| InChIKey | OZPJHRURWVEPLK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|