C18H16N3O4S- — CID 8973290
2,3-dimethoxy-6-[(Z)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoate (PubChem CID 8973290) has the molecular formula C18H16N3O4S- and a molecular weight of 370.41 g/mol. Its IUPAC name is 2,3-dimethoxy-6-[(Z)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoate.
| Compound Name | 2,3-dimethoxy-6-[(Z)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8973290 |
| Molecular Formula | C18H16N3O4S- |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2,3-dimethoxy-6-[(Z)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoate |
| SMILES | COc1ccc(/C=N\N=c2\sc3ccccc3n2C)c(C(=O)[O-])c1OC |
| InChI | InChI=1S/C18H17N3O4S/c1-21-12-6-4-5-7-14(12)26-18(21)20-19-10-11-8-9-13(24-2)16(25-3)15(11)17(22)23/h4-10H,1-3H3,(H,22,23)/p-1/b19-10-,20-18+ |
| InChIKey | WRNYOLQVHULNEL-MNJINHJASA-M |
| XLogP | 1.56 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|