C10H11N3OS — CID 6067375
(NE)-N-(3-propyl-1,3-benzothiazol-2-ylidene)nitrous amide (PubChem CID 6067375) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is (NE)-N-(3-propyl-1,3-benzothiazol-2-ylidene)nitrous amide.
| Compound Name | (NE)-N-(3-propyl-1,3-benzothiazol-2-ylidene)nitrous amide |
|---|---|
| PubChem CID | 6067375 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (NE)-N-(3-propyl-1,3-benzothiazol-2-ylidene)nitrous amide |
| SMILES | CCCn1/c(=N\N=O)sc2ccccc21 |
| InChI | InChI=1S/C10H11N3OS/c1-2-7-13-8-5-3-4-6-9(8)15-10(13)11-12-14/h3-6H,2,7H2,1H3/b11-10+ |
| InChIKey | JAFGQACPKHTHJJ-ZHACJKMWSA-N |
| XLogP | 2.69 |
| TPSA | 46.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|