C11H15N3OS — CID 175534018
(3-methyl-1,3-benzothiazol-2-ylidene)hydrazine;propanal (PubChem CID 175534018) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine;propanal.
| Compound Name | (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine;propanal |
|---|---|
| PubChem CID | 175534018 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (3-methyl-1,3-benzothiazol-2-ylidene)hydrazine;propanal |
| SMILES | CCC=O.Cn1c(=NN)sc2ccccc21 |
| InChI | InChI=1S/C8H9N3S.C3H6O/c1-11-6-4-2-3-5-7(6)12-8(11)10-9;1-2-3-4/h2-5H,9H2,1H3;3H,2H2,1H3 |
| InChIKey | RGGHUQHDNJCUGZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|