C13H12ClN3S — CID 56642950
(Z)-(3-phenyl-1,3-benzothiazol-2-ylidene)hydrazine;hydrochloride (PubChem CID 56642950) has the molecular formula C13H12ClN3S and a molecular weight of 277.78 g/mol. Its IUPAC name is (Z)-(3-phenyl-1,3-benzothiazol-2-ylidene)hydrazine;hydrochloride.
| Compound Name | (Z)-(3-phenyl-1,3-benzothiazol-2-ylidene)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 56642950 |
| Molecular Formula | C13H12ClN3S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (Z)-(3-phenyl-1,3-benzothiazol-2-ylidene)hydrazine;hydrochloride |
| SMILES | Cl.N/N=c1\sc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C13H11N3S.ClH/c14-15-13-16(10-6-2-1-3-7-10)11-8-4-5-9-12(11)17-13;/h1-9H,14H2;1H/b15-13-; |
| InChIKey | JLSWXDZZMKKRNZ-ZDCVYKBASA-N |
| XLogP | 2.89 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|