C10H13N5OS — CID 6886321
3-[(2Z)-2-hydrazinylidene-1,3-benzothiazol-3-yl]propanehydrazide (PubChem CID 6886321) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-[(2Z)-2-hydrazinylidene-1,3-benzothiazol-3-yl]propanehydrazide.
| Compound Name | 3-[(2Z)-2-hydrazinylidene-1,3-benzothiazol-3-yl]propanehydrazide |
|---|---|
| PubChem CID | 6886321 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[(2Z)-2-hydrazinylidene-1,3-benzothiazol-3-yl]propanehydrazide |
| SMILES | N/N=c1\sc2ccccc2n1CCC(=O)NN |
| InChI | InChI=1S/C10H13N5OS/c11-13-9(16)5-6-15-7-3-1-2-4-8(7)17-10(15)14-12/h1-4H,5-6,11-12H2,(H,13,16)/b14-10- |
| InChIKey | HUELETDMFXXIGM-UVTDQMKNSA-N |
| XLogP | -0.14 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|