C9H10N4OS — CID 3076156
2-(2-imino-1,3-benzothiazol-3-yl)acetohydrazide (PubChem CID 3076156) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(2-imino-1,3-benzothiazol-3-yl)acetohydrazide.
| Compound Name | 2-(2-imino-1,3-benzothiazol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 3076156 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(2-imino-1,3-benzothiazol-3-yl)acetohydrazide |
| SMILES | [H]/N=c1\sc2ccccc2n1CC(=O)NN |
| InChI | InChI=1S/C9H10N4OS/c10-9-13(5-8(14)12-11)6-3-1-2-4-7(6)15-9/h1-4,10H,5,11H2,(H,12,14)/b10-9- |
| InChIKey | DYIGPKKSBKEOHH-KTKRTIGZSA-N |
| XLogP | 0.17 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|