C10H9N5OS2 — CID 71575518
2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetohydrazide (PubChem CID 71575518) has the molecular formula C10H9N5OS2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetohydrazide.
| Compound Name | 2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetohydrazide |
|---|---|
| PubChem CID | 71575518 |
| Molecular Formula | C10H9N5OS2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetohydrazide |
| SMILES | NNC(=O)CSc1nnc2sc3ccccc3n12 |
| InChI | InChI=1S/C10H9N5OS2/c11-12-8(16)5-17-9-13-14-10-15(9)6-3-1-2-4-7(6)18-10/h1-4H,5,11H2,(H,12,16) |
| InChIKey | AWWCFTZSLXPFLD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|