C14H16N4OS2 — CID 2612662
N-butyl-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide (PubChem CID 2612662) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-butyl-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide.
| Compound Name | N-butyl-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2612662 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-butyl-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide |
| SMILES | CCCCNC(=O)CSc1nnc2sc3ccccc3n12 |
| InChI | InChI=1S/C14H16N4OS2/c1-2-3-8-15-12(19)9-20-13-16-17-14-18(13)10-6-4-5-7-11(10)21-14/h4-7H,2-3,8-9H2,1H3,(H,15,19) |
| InChIKey | SBLKLVRGUUHXPA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|