C14H16N4O2S2 — CID 35717885
N-(3-methoxypropyl)-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide (PubChem CID 35717885) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide.
| Compound Name | N-(3-methoxypropyl)-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 35717885 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-(3-methoxypropyl)-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nnc2sc3ccccc3n12 |
| InChI | InChI=1S/C14H16N4O2S2/c1-20-8-4-7-15-12(19)9-21-13-16-17-14-18(13)10-5-2-3-6-11(10)22-14/h2-3,5-6H,4,7-9H2,1H3,(H,15,19) |
| InChIKey | YAXWXGOTXUDNDK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|