C20H18N4O3S2 — CID 16599387
N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide (PubChem CID 16599387) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 16599387 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2sc3ccccc3n12)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H18N4O3S2/c25-18(21-8-7-13-5-6-15-16(11-13)27-10-9-26-15)12-28-19-22-23-20-24(19)14-3-1-2-4-17(14)29-20/h1-6,11H,7-10,12H2,(H,21,25) |
| InChIKey | IFHSBFXRZJKMOK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |