C20H16N2S — CID 14690176
6-methyl-N,3-diphenyl-1,3-benzothiazol-2-imine (PubChem CID 14690176) has the molecular formula C20H16N2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 6-methyl-N,3-diphenyl-1,3-benzothiazol-2-imine.
| Compound Name | 6-methyl-N,3-diphenyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 14690176 |
| Molecular Formula | C20H16N2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 6-methyl-N,3-diphenyl-1,3-benzothiazol-2-imine |
| SMILES | Cc1ccc2c(c1)s/c(=N\c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C20H16N2S/c1-15-12-13-18-19(14-15)23-20(21-16-8-4-2-5-9-16)22(18)17-10-6-3-7-11-17/h2-14H,1H3/b21-20- |
| InChIKey | LWTWQJQQFSLVDE-MRCUWXFGSA-N |
| XLogP | 5.23 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |