C23H17N3OS — CID 102071071
7-methyl-3-phenyl-1-phenylimino-5H-[1,3]thiazolo[3,4-a]quinoxalin-4-one (PubChem CID 102071071) has the molecular formula C23H17N3OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 7-methyl-3-phenyl-1-phenylimino-5H-[1,3]thiazolo[3,4-a]quinoxalin-4-one.
| Compound Name | 7-methyl-3-phenyl-1-phenylimino-5H-[1,3]thiazolo[3,4-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 102071071 |
| Molecular Formula | C23H17N3OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 7-methyl-3-phenyl-1-phenylimino-5H-[1,3]thiazolo[3,4-a]quinoxalin-4-one |
| SMILES | Cc1ccc2c(c1)[nH]c(=O)c1c(-c3ccccc3)s/c(=N\c3ccccc3)n12 |
| InChI | InChI=1S/C23H17N3OS/c1-15-12-13-19-18(14-15)25-22(27)20-21(16-8-4-2-5-9-16)28-23(26(19)20)24-17-10-6-3-7-11-17/h2-14H,1H3,(H,25,27)/b24-23- |
| InChIKey | LYQVYLQNDLUJLA-VHXPQNKSSA-N |
| XLogP | 5.05 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |