C23H20N4OS — CID 177414368
2-[(5-methyl-1H-pyrazol-3-yl)imino]-5,6-diphenyl-3-prop-2-enyl-1,3-thiazin-4-one (PubChem CID 177414368) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-[(5-methyl-1H-pyrazol-3-yl)imino]-5,6-diphenyl-3-prop-2-enyl-1,3-thiazin-4-one.
| Compound Name | 2-[(5-methyl-1H-pyrazol-3-yl)imino]-5,6-diphenyl-3-prop-2-enyl-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 177414368 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[(5-methyl-1H-pyrazol-3-yl)imino]-5,6-diphenyl-3-prop-2-enyl-1,3-thiazin-4-one |
| SMILES | C=CCn1c(=O)c(-c2ccccc2)c(-c2ccccc2)s/c1=N\c1cc(C)[nH]n1 |
| InChI | InChI=1S/C23H20N4OS/c1-3-14-27-22(28)20(17-10-6-4-7-11-17)21(18-12-8-5-9-13-18)29-23(27)24-19-15-16(2)25-26-19/h3-13,15H,1,14H2,2H3,(H,25,26)/b24-23- |
| InChIKey | VEBDTGWYQDFYGF-VHXPQNKSSA-N |
| XLogP | 4.69 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|