C20H21N3O2S2 — CID 8673103
N,N-dimethyl-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 8673103) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N,N-dimethyl-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8673103 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N,N-dimethyl-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(C)C)nc2sc(-c3ccccc3)c(C)c2c1=O |
| InChI | InChI=1S/C20H21N3O2S2/c1-5-11-23-19(25)16-13(2)17(14-9-7-6-8-10-14)27-18(16)21-20(23)26-12-15(24)22(3)4/h5-10H,1,11-12H2,2-4H3 |
| InChIKey | IMTAHOQJDNGKDF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|