C26H28N4O2S2 — CID 45354743
N-(1-cyanocyclohexyl)-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 45354743) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 45354743 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(5-methyl-4-oxo-6-phenyl-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NC2(C#N)CCCCC2)nc2sc(-c3ccccc3)c(C)c2c1=O |
| InChI | InChI=1S/C26H28N4O2S2/c1-4-15-30-24(32)20-17(2)21(19-11-7-5-8-12-19)34-23(20)28-25(30)33-18(3)22(31)29-26(16-27)13-9-6-10-14-26/h4-5,7-8,11-12,18H,1,6,9-10,13-15H2,2-3H3,(H,29,31) |
| InChIKey | NYUCGNWNXZAJKA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|