C21H25N5OS — CID 7168972
(2S)-N-(1-cyanocyclohexyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 7168972) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is (2S)-N-(1-cyanocyclohexyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(1-cyanocyclohexyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7168972 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2S)-N-(1-cyanocyclohexyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)NC2(C#N)CCCCC2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H25N5OS/c1-3-14-26-18(17-10-6-4-7-11-17)24-25-20(26)28-16(2)19(27)23-21(15-22)12-8-5-9-13-21/h3-4,6-7,10-11,16H,1,5,8-9,12-14H2,2H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | HYQAKBZZRHNNIE-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|