C21H22N2S — CID 5167345
4-phenyl-3-prop-2-enyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine (PubChem CID 5167345) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 4-phenyl-3-prop-2-enyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-phenyl-3-prop-2-enyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5167345 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-phenyl-3-prop-2-enyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine |
| SMILES | C=CCn1c(-c2ccccc2)cs/c1=N\c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H22N2S/c1-5-11-23-19(18-9-7-6-8-10-18)14-24-21(23)22-20-16(3)12-15(2)13-17(20)4/h5-10,12-14H,1,11H2,2-4H3/b22-21- |
| InChIKey | JNGGGINWYDRMIW-DQRAZIAOSA-N |
| XLogP | 5.56 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|