C16H14N2O2S3 — CID 6041804
(NE)-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 6041804) has the molecular formula C16H14N2O2S3 and a molecular weight of 362.50 g/mol. Its IUPAC name is (NE)-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide.
| Compound Name | (NE)-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6041804 |
| Molecular Formula | C16H14N2O2S3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (NE)-N-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | C=CCn1c(-c2ccccc2)cs/c1=N/S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H14N2O2S3/c1-2-10-18-14(13-7-4-3-5-8-13)12-22-16(18)17-23(19,20)15-9-6-11-21-15/h2-9,11-12H,1,10H2/b17-16+ |
| InChIKey | OUBKSPGNABKSNK-WUKNDPDISA-N |
| XLogP | 3.75 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|