C20H18N4S — CID 139219009
3-benzyl-N-(5-methyl-1H-pyrazol-3-yl)-4-phenyl-1,3-thiazol-2-imine (PubChem CID 139219009) has the molecular formula C20H18N4S and a molecular weight of 346.46 g/mol. Its IUPAC name is 3-benzyl-N-(5-methyl-1H-pyrazol-3-yl)-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-benzyl-N-(5-methyl-1H-pyrazol-3-yl)-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 139219009 |
| Molecular Formula | C20H18N4S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-benzyl-N-(5-methyl-1H-pyrazol-3-yl)-4-phenyl-1,3-thiazol-2-imine |
| SMILES | Cc1cc(/N=c2\scc(-c3ccccc3)n2Cc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H18N4S/c1-15-12-19(23-22-15)21-20-24(13-16-8-4-2-5-9-16)18(14-25-20)17-10-6-3-7-11-17/h2-12,14H,13H2,1H3,(H,22,23)/b21-20- |
| InChIKey | SLHBHRLEAVGWPK-MRCUWXFGSA-N |
| XLogP | 4.53 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|