C26H24BrN2S2- — CID 21203718
N-(4-methylphenyl)-4-(4-methylsulfanylphenyl)-5-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine bromide (PubChem CID 21203718) has the molecular formula C26H24BrN2S2- and a molecular weight of 508.53 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-(4-methylsulfanylphenyl)-5-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine bromide.
| Compound Name | N-(4-methylphenyl)-4-(4-methylsulfanylphenyl)-5-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine bromide |
|---|---|
| PubChem CID | 21203718 |
| Molecular Formula | C26H24BrN2S2- |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | N-(4-methylphenyl)-4-(4-methylsulfanylphenyl)-5-phenyl-3-prop-2-enyl-1,3-thiazol-2-imine bromide |
| SMILES | C=CCn1c(-c2ccc(SC)cc2)c(-c2ccccc2)s/c1=N\c1ccc(C)cc1.[Br-] |
| InChI | InChI=1S/C26H24N2S2.BrH/c1-4-18-28-24(20-12-16-23(29-3)17-13-20)25(21-8-6-5-7-9-21)30-26(28)27-22-14-10-19(2)11-15-22;/h4-17H,1,18H2,2-3H3;1H/p-1/b27-26-; |
| InChIKey | AQKDCWGBHBDUOB-JTHROIFXSA-M |
| XLogP | 4.34 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|