C19H18N2S — CID 102517224
2-methylsulfanyl-4,5-diphenyl-1-prop-2-enylimidazole (PubChem CID 102517224) has the molecular formula C19H18N2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-methylsulfanyl-4,5-diphenyl-1-prop-2-enylimidazole.
| Compound Name | 2-methylsulfanyl-4,5-diphenyl-1-prop-2-enylimidazole |
|---|---|
| PubChem CID | 102517224 |
| Molecular Formula | C19H18N2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-methylsulfanyl-4,5-diphenyl-1-prop-2-enylimidazole |
| SMILES | C=CCn1c(SC)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H18N2S/c1-3-14-21-18(16-12-8-5-9-13-16)17(20-19(21)22-2)15-10-6-4-7-11-15/h3-13H,1,14H2,2H3 |
| InChIKey | NKIRPOQKYKIXDC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|