C14H13N5OS — CID 135514920
2-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)-3H-quinazolin-4-one (PubChem CID 135514920) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)-3H-quinazolin-4-one.
| Compound Name | 2-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135514920 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)-3H-quinazolin-4-one |
| SMILES | C=CCn1c(SC)nnc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H13N5OS/c1-3-8-19-12(17-18-14(19)21-2)11-15-10-7-5-4-6-9(10)13(20)16-11/h3-7H,1,8H2,2H3,(H,15,16,20) |
| InChIKey | NBVCDZTVUQXJQP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|