C21H18FN5OS — CID 135745911
2-[(1S)-1-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-3H-quinazolin-4-one (PubChem CID 135745911) has the molecular formula C21H18FN5OS and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(1S)-1-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1S)-1-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135745911 |
| Molecular Formula | C21H18FN5OS |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[(1S)-1-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-3H-quinazolin-4-one |
| SMILES | C=CCn1c(S[C@@H](C)c2nc3ccccc3c(=O)[nH]2)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FN5OS/c1-3-12-27-19(14-8-10-15(22)11-9-14)25-26-21(27)29-13(2)18-23-17-7-5-4-6-16(17)20(28)24-18/h3-11,13H,1,12H2,2H3,(H,23,24,28)/t13-/m0/s1 |
| InChIKey | SXTLKQQOZVFPAY-ZDUSSCGKSA-N |
| XLogP | 4.36 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|