C21H20N6O3S — CID 135640936
N-[1-[5-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]furan-2-carboxamide (PubChem CID 135640936) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is N-[1-[5-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[5-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135640936 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-[1-[5-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]furan-2-carboxamide |
| SMILES | C=CCn1c(SCc2nc3ccccc3c(=O)[nH]2)nnc1C(C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H20N6O3S/c1-3-10-27-18(13(2)22-20(29)16-9-6-11-30-16)25-26-21(27)31-12-17-23-15-8-5-4-7-14(15)19(28)24-17/h3-9,11,13H,1,10,12H2,2H3,(H,22,29)(H,23,24,28) |
| InChIKey | LJQKKEMSGXMHCG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|