C13H14N4O4S — CID 71945395
2-[[5-[(furan-2-carbonylamino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 71945395) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-[[5-[(furan-2-carbonylamino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(furan-2-carbonylamino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 71945395 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[[5-[(furan-2-carbonylamino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | C=CCn1c(CNC(=O)c2ccco2)nnc1SCC(=O)O |
| InChI | InChI=1S/C13H14N4O4S/c1-2-5-17-10(15-16-13(17)22-8-11(18)19)7-14-12(20)9-4-3-6-21-9/h2-4,6H,1,5,7-8H2,(H,14,20)(H,18,19) |
| InChIKey | DZZFWGBRXCYPHY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|