C20H16ClN5OS — CID 135568720
6-chloro-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135568720) has the molecular formula C20H16ClN5OS and a molecular weight of 409.90 g/mol. Its IUPAC name is 6-chloro-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135568720 |
| Molecular Formula | C20H16ClN5OS |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 6-chloro-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | C=CCn1c(SCc2nc3ccc(Cl)cc3c(=O)[nH]2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H16ClN5OS/c1-2-10-26-18(13-6-4-3-5-7-13)24-25-20(26)28-12-17-22-16-9-8-14(21)11-15(16)19(27)23-17/h2-9,11H,1,10,12H2,(H,22,23,27) |
| InChIKey | VYKWLOBNGUZSJY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|